| product Name |
N-(4-chlorophenyl)-4-fluorobenzenesulfonamide |
| Synonyms |
benzenesulfonamide, N-(4-chlorophenyl)-4-fluoro- |
| Molecular Formula |
C12H9ClFNO2S |
| Molecular Weight |
285.7218 |
| InChI |
InChI=1/C12H9ClFNO2S/c13-9-1-5-11(6-2-9)15-18(16,17)12-7-3-10(14)4-8-12/h1-8,15H |
| CAS Registry Number |
312-57-2 |
| Molecular Structure |
|
| Density |
1.467g/cm3 |
| Boiling point |
402.6°C at 760 mmHg |
| Refractive index |
1.625 |
| Flash point |
197.3°C |
| Vapour Pressur |
1.08E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|