product Name |
4-(Trifluoromethylsulfonyl)benzonitrile |
Synonyms |
4-Cyanophenyl trifluoromethyl sulphone~4-(Trifluoromethylsulphonyl)benzonitrile; 3-fluoropyridine-2-carbaldehyde |
Molecular Formula |
C6H4FNO |
Molecular Weight |
125.1005 |
InChI |
InChI=1/C6H4FNO/c7-5-2-1-3-8-6(5)4-9/h1-4H |
CAS Registry Number |
312-21-0 |
Molecular Structure |
|
Density |
1.269g/cm3 |
Melting point |
84-88℃ |
Boiling point |
166.5°C at 760 mmHg |
Refractive index |
1.543 |
Flash point |
54.5°C |
Vapour Pressur |
1.78mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|