| product Name |
bicyclo[1.1.1]pentane |
| Synonyms |
Bicyclo(1.1.1)pentane |
| Molecular Formula |
C5H8 |
| Molecular Weight |
68.117 |
| InChI |
InChI=1/C5H8/c1-4-2-5(1)3-4/h4-5H,1-3H2 |
| CAS Registry Number |
311-75-1 |
| Molecular Structure |
|
| Density |
0.976g/cm3 |
| Boiling point |
49.1°C at 760 mmHg |
| Refractive index |
1.517 |
| Vapour Pressur |
316mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|