product Name |
1,3-Diisopropylbenzene |
Synonyms |
1,3-Bis(1-methylethyl)benzene; AI3-08224; BRN 1905828; Benzene, 1,3-bis(1-methylethyl)-; Benzene, m-diisopropyl-; HSDB 5325; m-Diisopropylbenzene; m-Diisopropylbenzol; 1,3-di(propan-2-yl)benzene |
Molecular Formula |
C12H18 |
Molecular Weight |
162.2713 |
InChI |
InChI=1/C12H18/c1-9(2)11-6-5-7-12(8-11)10(3)4/h5-10H,1-4H3 |
CAS Registry Number |
99-62-7 |
EINECS |
202-773-1 |
Molecular Structure |
|
Density |
0.855g/cm3 |
Melting point |
-63℃ |
Boiling point |
203.2°C at 760 mmHg |
Refractive index |
1.488 |
Flash point |
76.7°C |
Vapour Pressur |
0.401mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|