| product Name |
3-(4-Hydroxyphenyl)lactate |
| Synonyms |
3-(4-Hydroxyphenyl)-2-hydroxypropanoic acid; 2-hydroxy-3-(4-hydroxyphenyl)propanoic acid; (3R)-3-(hexanoyloxy)-4-(trimethylammonio)butanoate; 2-hydroxy-2-(4-hydroxyphenyl)propanoic acid; 2-hydroxy-3-(4-hydroxyphenyl)propanoate |
| Molecular Formula |
C9H9O4 |
| Molecular Weight |
181.1659 |
| InChI |
InChI=1/C9H10O4/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-4,8,10-11H,5H2,(H,12,13)/p-1 |
| CAS Registry Number |
306-23-0 |
| Molecular Structure |
|
| Boiling point |
414.439°C at 760 mmHg |
| Flash point |
218.597°C |
| Vapour Pressur |
0mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:;
|
| Safety Description |
S26:;
S36:;
|
|