| product Name |
1,5-anhydro-1-[5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-4-oxo-4H-chromen-8-yl]hexitol |
| Synonyms |
|
| Molecular Formula |
C22H22O11 |
| Molecular Weight |
462.4035 |
| InChI |
InChI=1/C22H22O11/c1-31-14-4-8(2-3-9(14)24)13-6-12(27)16-10(25)5-11(26)17(21(16)32-13)22-20(30)19(29)18(28)15(7-23)33-22/h2-6,15,18-20,22-26,28-30H,7H2,1H3 |
| CAS Registry Number |
301-16-6 |
| Molecular Structure |
|
| Density |
1.649g/cm3 |
| Boiling point |
781.6°C at 760 mmHg |
| Refractive index |
1.717 |
| Flash point |
273.9°C |
| Vapour Pressur |
9.99E-26mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|