| product Name |
2-thiocyanatoethyl laurate |
| Synonyms |
Lethane 60; 2-Thiocyanatoethyl dodecanoate; 2-Thiocyanatoethyl laurate; 2-Thiocyanoethyl coconate; 2-Thiocyanoethyl dodecanoate; 2-Thiocyanoethyl laurate; 2-Thiokyanatoethylester kyseliny laurove; 2-Thiokyanatoethylester kyseliny laurove [Czech]; 3-03-00-00286 (Beilstein Handbook Reference); Caswell No. 085; Dodecanoic acid 2-thiocyanatoethyl ester; EPA Pesticide Chemical Code 010101; Lauric acid ester with 2-hydroxyethyl thiocyanate; Lethane 384 special; NSC 403654; Thiocyanic acid, 2-hydroxyethyl ester laurate (ester); Thiocyanic acid, 2-hydroxyethyl ester, laurate; beta-Thiocyanoethyl laurate; Dodecanoic acid, 2-thiocyanatoethyl ester; Dodecanoic acid, 2-thiocyanatoethyl ester (9CI); Lauric acid, 2-thiocyanatoethyl ester |
| Molecular Formula |
C15H27NO2S |
| Molecular Weight |
285.4454 |
| InChI |
InChI=1/C15H27NO2S/c1-2-3-4-5-6-7-8-9-10-11-15(17)18-12-13-19-14-16/h2-13H2,1H3 |
| CAS Registry Number |
301-11-1 |
| EINECS |
206-109-1 |
| Molecular Structure |
|
| Density |
0.994g/cm3 |
| Boiling point |
393.9°C at 760 mmHg |
| Refractive index |
1.477 |
| Flash point |
192°C |
| Vapour Pressur |
2.05E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|