| product Name |
methyl 4,7,10,13,16,19-docosahexaenoate |
| Molecular Formula |
C23H34O2 |
| Molecular Weight |
342.5149 |
| InChI |
InChI=1/C23H34O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23(24)25-2/h4-5,7-8,10-11,13-14,16-17,19-20H,3,6,9,12,15,18,21-22H2,1-2H3/b5-4+,8-7+,11-10+,14-13+,17-16+,20-19+ |
| CAS Registry Number |
301-01-9 |
| Molecular Structure |
|
| Density |
0.917g/cm3 |
| Boiling point |
429.9°C at 760 mmHg |
| Refractive index |
1.504 |
| Flash point |
103.9°C |
| Vapour Pressur |
1.35E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|