| product Name |
3-Hydroxybutyric acid |
| Synonyms |
dl-B-hydroxybutyric acid free acid*practical grad; (3R)-3-hydroxybutanoate |
| Molecular Formula |
C4H7O3 |
| Molecular Weight |
103.0971 |
| InChI |
InChI=1/C4H8O3/c1-3(5)2-4(6)7/h3,5H,2H2,1H3,(H,6,7)/p-1/t3-/m1/s1 |
| CAS Registry Number |
300-85-6 |
| EINECS |
206-099-9 |
| Molecular Structure |
|
| Boiling point |
269.2°C at 760 mmHg |
| Flash point |
121°C |
| Vapour Pressur |
0.000979mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
