product Name |
2,4,4'-Trimethoxybenzophenone |
Synonyms |
-; (2,4-dimethoxyphenyl)(4-methoxyphenyl)methanone |
Molecular Formula |
C16H16O4 |
Molecular Weight |
272.2958 |
InChI |
InChI=1/C16H16O4/c1-18-12-6-4-11(5-7-12)16(17)14-9-8-13(19-2)10-15(14)20-3/h4-10H,1-3H3 |
CAS Registry Number |
4038-15-7 |
Molecular Structure |
|
Density |
1.136g/cm3 |
Boiling point |
444°C at 760 mmHg |
Refractive index |
1.547 |
Flash point |
197.9°C |
Vapour Pressur |
4.43E-08mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|