product Name |
chlorosulfonylacetyl chloride |
Synonyms |
Acetyl chloride, 2-(chlorosulfonyl)-; (Chlorosulphonyl)acetyl chloride; Acetyl chloride, (chlorosulfonyl)-; 8-[(2,5-dimethoxyphenyl)carbonyl]-2-[2-methyl-3-(2,4,5-trimethoxyphenyl)acryloyl]-2,8-diazaspiro[4.5]decane |
Molecular Formula |
C30H38N2O7 |
Molecular Weight |
538.6319 |
InChI |
InChI=1/C30H38N2O7/c1-20(15-21-16-26(38-5)27(39-6)18-25(21)37-4)28(33)32-14-11-30(19-32)9-12-31(13-10-30)29(34)23-17-22(35-2)7-8-24(23)36-3/h7-8,15-18H,9-14,19H2,1-6H3 |
CAS Registry Number |
4025-77-8 |
EINECS |
223-693-3 |
Molecular Structure |
|
Density |
1.24g/cm3 |
Boiling point |
753.9°C at 760 mmHg |
Refractive index |
1.595 |
Flash point |
409.7°C |
Vapour Pressur |
1.29E-22mmHg at 25°C |
Hazard Symbols |
C:Corrosive;
|
Risk Codes |
R14:Reacts violently with water.;
R34:Causes burns.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S8:Keep container dry.;
|
|