product Name |
exo-(±)-Norborneol |
Synonyms |
2-exo-Norborneol = exo-Norborneol; (1R,2R,4S)-bicyclo[2.2.1]heptan-2-ol; (1S,2S,4R)-bicyclo[2.2.1]heptan-2-ol; (2S,4R)-bicyclo[2.2.1]heptan-2-amine |
Molecular Formula |
C7H13N |
Molecular Weight |
111.1848 |
InChI |
InChI=1/C7H13N/c8-7-4-5-1-2-6(7)3-5/h5-7H,1-4,8H2/t5-,6?,7+/m1/s1 |
CAS Registry Number |
497-37-0 |
EINECS |
207-845-6 |
Molecular Structure |
|
Density |
0.985g/cm3 |
Melting point |
117-119℃ |
Boiling point |
160°C at 760 mmHg |
Refractive index |
1.512 |
Flash point |
35°C |
Vapour Pressur |
2.44mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|