| product Name |
endo-(±)-Norborneol |
| Synonyms |
endo-(?-2-Norbornanol; (1R,2S,4S)-bicyclo[2.2.1]heptan-2-ol |
| Molecular Formula |
C7H12O |
| Molecular Weight |
112.1696 |
| InChI |
InChI=1/C7H12O/c8-7-4-5-1-2-6(7)3-5/h5-8H,1-4H2/t5-,6+,7-/m0/s1 |
| CAS Registry Number |
497-36-9 |
| EINECS |
207-844-0 |
| Molecular Structure |
|
| Density |
1.098g/cm3 |
| Melting point |
148-154℃ |
| Boiling point |
176.499°C at 760 mmHg |
| Refractive index |
1.537 |
| Flash point |
74.376°C |
| Vapour Pressur |
0.332mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
