| product Name |
2-methyl-2-butenal |
| Synonyms |
Methylbutenal; tiglaldehyde; guaiol; 2-Methylcrotonaldehyde~Tiglic aldehyde |
| Molecular Formula |
C5H8O |
| Molecular Weight |
84.11
|
| InChI |
InChI=1/C5H8O/c1-3-5(2)4-6/h3-4H,1-2H3/b5-3+ |
| CAS Registry Number |
497-03-0 |
| EINECS |
207-833-0 |
| Molecular Structure |
|
| Density |
0.871 |
| Boiling point |
115-118℃ (752 torr) |
| Refractive index |
1.447 |
| Flash point |
18℃ |
| Hazard Symbols |
 F:Highly flammable;
 Xi:Irritant;
|
| Risk Codes |
R11:Highly flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
