| product Name |
1,2-Dibenzoylethane |
| Synonyms |
1,2-Dibenzoylethane,(1,4-Diphenyl-1,4-butanedione); 1,4-Diphenyl-1,4-butanedione; 1,4-diphenylbutane-1,4-dione; 1,4-diphenyl-1,4-butadione |
| Molecular Formula |
C16H14O2 |
| Molecular Weight |
238.2812 |
| InChI |
InChI=1/C16H14O2/c17-15(13-7-3-1-4-8-13)11-12-16(18)14-9-5-2-6-10-14/h1-10H,11-12H2 |
| CAS Registry Number |
495-71-6 |
| Molecular Structure |
|
| Density |
1.116g/cm3 |
| Boiling point |
407.2°C at 760 mmHg |
| Refractive index |
1.574 |
| Flash point |
152.5°C |
| Vapour Pressur |
7.67E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|