| product Name |
Hippuric acid |
| Synonyms |
N-Benzoylglycine; [(phenylcarbonyl)amino]acetate |
| Molecular Formula |
C9H8NO3 |
| Molecular Weight |
178.1653 |
| InChI |
InChI=1/C9H9NO3/c11-8(12)6-10-9(13)7-4-2-1-3-5-7/h1-5H,6H2,(H,10,13)(H,11,12)/p-1 |
| CAS Registry Number |
495-69-2 |
| EINECS |
207-806-3 |
| Molecular Structure |
|
| Melting point |
188-191℃ |
| Boiling point |
464.1°C at 760 mmHg |
| Flash point |
234.5°C |
| Vapour Pressur |
2.06E-09mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
