| product Name |
Azoxybenzene |
| Synonyms |
Diphenyldiazene-1-oxide; Azoxylbenzene; Fenazox; [(Z)-phenyl-NNO-azoxy]benzene; [(E)-phenyl-NNO-azoxy]benzene |
| Molecular Formula |
C12H10N2O |
| Molecular Weight |
198.22 |
| InChI |
InChI=1/C12H10N2O/c15-14(12-9-5-2-6-10-12)13-11-7-3-1-4-8-11/h1-10H |
| CAS Registry Number |
495-48-7 |
| EINECS |
207-802-1 |
| Molecular Structure |
|
| Melting point |
32-36℃ |
| Refractive index |
1.582 |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/22:Harmful by inhalation and if swallowed.;
|
| Safety Description |
S28A:After contact with skin, wash immediately with plenty of water.;
|
|
