product Name |
alpha-D(+)-Glucose |
Synonyms |
Glucose solution; D-Glucose-12C6, 13C-depleted; D-(+)-Glucose; alpha-D-Glucopyranose; Alpha-D-Glucose; DEXTROSUM; D-GLC; D-(+)-DEXTROSE; GLUCOSE STANDARD; GLUCOSUM; D-(12C6)glucopyranose |
Molecular Formula |
12C6H12O6 |
Molecular Weight |
180.0917 |
InChI |
InChI=1/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4+,5-,6?/m1/s1/i1+0,2+0,3+0,4+0,5+0,6+0 |
CAS Registry Number |
492-62-6 |
EINECS |
207-757-8 |
Molecular Structure |
|
Density |
1.732g/cm3 |
Melting point |
156-158℃ |
Refractive index |
1.635 |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|