product Name |
4'-Methoxy-3,5,7-trihydroxyflavone |
Synonyms |
Kaempferide; 3,5,7-Trihydroxy-4-methoxyflavone; 3,5,7-trihydroxy-2-(4-methoxyphenyl)-4H-chromen-4-one |
Molecular Formula |
C16H12O6 |
Molecular Weight |
300.2629 |
InChI |
InChI=1/C16H12O6/c1-21-10-4-2-8(3-5-10)16-15(20)14(19)13-11(18)6-9(17)7-12(13)22-16/h2-7,17-18,20H,1H3 |
CAS Registry Number |
491-54-3 |
EINECS |
207-738-4 |
Molecular Structure |
|
Density |
1.538g/cm3 |
Boiling point |
543.8°C at 760 mmHg |
Refractive index |
1.709 |
Flash point |
207.1°C |
Vapour Pressur |
1.94E-12mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|