| product Name |
2,5-Dimethylresorcinol |
| Synonyms |
-; 2,5-dimethylbenzene-1,3-diol |
| Molecular Formula |
C8H10O2 |
| Molecular Weight |
138.1638 |
| InChI |
InChI=1/C8H10O2/c1-5-3-7(9)6(2)8(10)4-5/h3-4,9-10H,1-2H3 |
| CAS Registry Number |
488-87-9 |
| EINECS |
207-688-3 |
| Molecular Structure |
|
| Density |
1.162g/cm3 |
| Melting point |
161℃ |
| Boiling point |
284.1°C at 760 mmHg |
| Refractive index |
1.582 |
| Flash point |
140.8°C |
| Vapour Pressur |
0.00178mmHg at 25°C |
| Hazard Symbols |
Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|