| product Name |
Tetrabromocatechol |
| Synonyms |
Tetrabromopyrocatechol; Tetrabromocatechol, (Tetrabromopyrocatechol); 3,4,5,6-tetrabromobenzene-1,2-diol |
| Molecular Formula |
C6H2Br4O2 |
| Molecular Weight |
425.6949 |
| InChI |
InChI=1/C6H2Br4O2/c7-1-2(8)4(10)6(12)5(11)3(1)9/h11-12H |
| CAS Registry Number |
488-47-1 |
| EINECS |
207-678-9 |
| Molecular Structure |
|
| Density |
2.818g/cm3 |
| Melting point |
189-193℃ |
| Boiling point |
339.3°C at 760 mmHg |
| Refractive index |
1.737 |
| Flash point |
159°C |
| Vapour Pressur |
4.73E-05mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
