| product Name |
1,2,3,4-Tetramethylbenzene |
| Synonyms |
Prehenitene; 1,2,3,4-tetramethyl-benze |
| Molecular Formula |
C10H14 |
| Molecular Weight |
134.2182 |
| InChI |
InChI=1/C10H14/c1-7-5-6-8(2)10(4)9(7)3/h5-6H,1-4H3 |
| CAS Registry Number |
488-23-3 |
| EINECS |
207-673-1 |
| Molecular Structure |
|
| Density |
0.868g/cm3 |
| Boiling point |
204°C at 760 mmHg |
| Refractive index |
1.501 |
| Flash point |
69.7°C |
| Vapour Pressur |
0.385mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
