| product Name |
2,3,4,5,6-Pentamethylbenzyl alcohol |
| Synonyms |
-; (pentamethylphenyl)methanol |
| Molecular Formula |
C12H18O |
| Molecular Weight |
178.2707 |
| InChI |
InChI=1/C12H18O/c1-7-8(2)10(4)12(6-13)11(5)9(7)3/h13H,6H2,1-5H3 |
| CAS Registry Number |
484-66-2 |
| EINECS |
207-609-2 |
| Molecular Structure |
|
| Density |
0.965g/cm3 |
| Boiling point |
256°C at 760 mmHg |
| Refractive index |
1.527 |
| Flash point |
116°C |
| Vapour Pressur |
0.00816mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
