| product Name |
6-hydroxy-4,7-dimethoxybenzofuran-5-yl methyl ketone |
| Synonyms |
Khellinone; 5-Acetyl-6-hydroxy-4,7-dimethoxybenzo[b]furan; 1-(6-hydroxy-4,7-dimethoxy-1-benzofuran-5-yl)ethanone |
| Molecular Formula |
C12H12O5 |
| Molecular Weight |
236.2207 |
| InChI |
InChI=1/C12H12O5/c1-6(13)8-9(14)12(16-3)11-7(4-5-17-11)10(8)15-2/h4-5,14H,1-3H3 |
| CAS Registry Number |
484-51-5 |
| EINECS |
207-607-1 |
| Molecular Structure |
|
| Density |
1.281g/cm3 |
| Boiling point |
366.3°C at 760 mmHg |
| Refractive index |
1.583 |
| Flash point |
175.3°C |
| Vapour Pressur |
7.02E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
