product Name |
9-Phenanthrol |
Synonyms |
9-Hydroxyphenanthrene; phenanthren-9-ol |
Molecular Formula |
C14H10O |
Molecular Weight |
194.2286 |
InChI |
InChI=1/C14H10O/c15-14-9-10-5-1-2-6-11(10)12-7-3-4-8-13(12)14/h1-9,15H |
CAS Registry Number |
484-17-3 |
EINECS |
207-602-4 |
Molecular Structure |
|
Density |
1.244g/cm3 |
Melting point |
139-143℃ |
Boiling point |
404.5°C at 760 mmHg |
Refractive index |
1.753 |
Flash point |
197.7°C |
Vapour Pressur |
4.02E-07mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|