| product Name |
9-Phenanthrol |
| Synonyms |
9-Hydroxyphenanthrene; phenanthren-9-ol |
| Molecular Formula |
C14H10O |
| Molecular Weight |
194.2286 |
| InChI |
InChI=1/C14H10O/c15-14-9-10-5-1-2-6-11(10)12-7-3-4-8-13(12)14/h1-9,15H |
| CAS Registry Number |
484-17-3 |
| EINECS |
207-602-4 |
| Molecular Structure |
|
| Density |
1.244g/cm3 |
| Melting point |
139-143℃ |
| Boiling point |
404.5°C at 760 mmHg |
| Refractive index |
1.753 |
| Flash point |
197.7°C |
| Vapour Pressur |
4.02E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
