product Name |
Plumbagin |
Synonyms |
5-Hydroxy-2-methyl-1,4-naphthoquinone; Plumbagin,95%; Plumbagin from Plumbago indica; 5-hydroxy-2-methylnaphthalene-1,4-dione |
Molecular Formula |
C11H8O3 |
Molecular Weight |
188.1794 |
InChI |
InChI=1/C11H8O3/c1-6-5-9(13)10-7(11(6)14)3-2-4-8(10)12/h2-5,12H,1H3 |
CAS Registry Number |
481-42-5 |
EINECS |
207-569-6 |
Molecular Structure |
|
Density |
1.354g/cm3 |
Melting point |
75-78℃ |
Boiling point |
383.9°C at 760 mmHg |
Refractive index |
1.63 |
Flash point |
200.2°C |
Vapour Pressur |
1.92E-06mmHg at 25°C |
Hazard Symbols |
T:Toxic;
|
Risk Codes |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|