| product Name |
1H-indol-3-ol |
| Synonyms |
3-Hydroxyindole |
| Molecular Formula |
C8H7NO |
| Molecular Weight |
133.15 |
| InChI |
InChI=1/C8H7NO/c10-8-5-9-7-4-2-1-3-6(7)8/h1-5,9-10H |
| CAS Registry Number |
480-93-3 |
| Molecular Structure |
|
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
