| product Name |
1,8,9-trihydroxyanthracene |
| Synonyms |
1,8,9-Anthracenetriol; 1,8-dihydroxyanthrone |
| Molecular Formula |
C14H10O3 |
| Molecular Weight |
226.23 |
| InChI |
InChI=1/C14H10O3/c15-10-5-1-3-8-7-9-4-2-6-11(16)13(9)14(17)12(8)10/h1-7,15-17H |
| CAS Registry Number |
480-22-8 |
| Molecular Structure |
|
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
