| product Name |
2-Ethylbutanal |
| Synonyms |
Butanal, 2-ethyl-; 2-Ethylbutyraldehyde; 2-Ethylbutyric aldehyde; 2-Ethylbutyric aledhyde; 3-Formylpentane; 4-01-00-03310 (Beilstein Handbook Reference); Aldehyde 2-ethylbutyrique; Aldehyde 2-ethylbutyrique [French]; BRN 1209330; Butyraldehyde, 2-ethyl-; Diethyl acetaldehyde; Diethylacetaldehyde; Ethyl butyraldehyde; FEMA No. 2426; NSC 6757; alpha-Ethylbutanal; alpha-Ethylbutyraldehyde; 2-Ethylbutyraldehyde [UN1178] [Flammable liquid]; UN1178 |
| Molecular Formula |
C6H12O |
| Molecular Weight |
100.1589 |
| InChI |
InChI=1/C6H12O/c1-3-6(4-2)5-7/h5-6H,3-4H2,1-2H3 |
| CAS Registry Number |
97-96-1 |
| EINECS |
202-623-5 |
| Molecular Structure |
|
| Density |
0.799g/cm3 |
| Boiling point |
118.1°C at 760 mmHg |
| Refractive index |
1.394 |
| Flash point |
21.1°C |
| Vapour Pressur |
16.9mmHg at 25°C |
| Hazard Symbols |
 F:Highly flammable;
 Xi:Irritant;
|
| Risk Codes |
R11:Highly flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S16:Keep away from sources of ignition - No smoking.;
S24/25:Avoid contact with skin and eyes.;
|
