| product Name |
(-)-Carvyl propionate |
| Synonyms |
()-Carvyl propionate,mixture of isomers; p-mentha-1(6),8-dien-2-yl propionate; 2-methyl-5-(prop-1-en-2-yl)cyclohex-2-en-1-yl propanoate; (1S,5S)-2-methyl-5-(prop-1-en-2-yl)cyclohex-2-en-1-yl propanoate; (1R,5S)-2-methyl-5-(prop-1-en-2-yl)cyclohex-2-en-1-yl propanoate; (1S,5R)-2-methyl-5-(prop-1-en-2-yl)cyclohex-2-en-1-yl propanoate; (1R,5R)-2-methyl-5-(prop-1-en-2-yl)cyclohex-2-en-1-yl propanoate |
| Molecular Formula |
C13H20O2 |
| Molecular Weight |
208.2967 |
| InChI |
InChI=1/C13H20O2/c1-5-13(14)15-12-8-11(9(2)3)7-6-10(12)4/h6,11-12H,2,5,7-8H2,1,3-4H3/t11-,12-/m1/s1 |
| CAS Registry Number |
97-45-0 |
| EINECS |
202-583-9 |
| Molecular Structure |
|
| Density |
0.95g/cm3 |
| Boiling point |
287.5°C at 760 mmHg |
| Refractive index |
1.475 |
| Flash point |
107.8°C |
| Vapour Pressur |
0.00247mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|