| product Name |
1-(3-fluorophenyl)-2-thiourea |
| Synonyms |
3-Fluorophenylthiourea; 1-(3-fluorophenyl)thiourea |
| Molecular Formula |
C7H7FN2S |
| Molecular Weight |
170.2073 |
| InChI |
InChI=1/C7H7FN2S/c8-5-2-1-3-6(4-5)10-7(9)11/h1-4H,(H3,9,10,11) |
| CAS Registry Number |
458-05-9 |
| Molecular Structure |
|
| Density |
1.397g/cm3 |
| Boiling point |
259.3°C at 760 mmHg |
| Refractive index |
1.692 |
| Flash point |
110.6°C |
| Vapour Pressur |
0.0131mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R25:Toxic if swallowed.;
|
| Safety Description |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|