| product Name |
3-fluorobenzamide |
| Synonyms |
m-Fluorobenzamide |
| Molecular Formula |
C7H6FNO |
| Molecular Weight |
139.127 |
| InChI |
InChI=1/C7H6FNO/c8-6-3-1-2-5(4-6)7(9)10/h1-4H,(H2,9,10) |
| CAS Registry Number |
455-37-8 |
| EINECS |
207-247-5 |
| Molecular Structure |
|
| Density |
1.238g/cm3 |
| Melting point |
129-132℃ |
| Boiling point |
238.4°C at 760 mmHg |
| Refractive index |
1.538 |
| Flash point |
98°C |
| Vapour Pressur |
0.0426mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
