| product Name |
2'-fluoropropiophenone |
| Synonyms |
2'-fluoro-1-phenylpropan-1-one; 1-(2'-fluorophenyl)propan-1-one |
| Molecular Formula |
C9H9FO |
| Molecular Weight |
152.1656 |
| InChI |
InChI=1/C9H9FO/c1-2-9(11)7-5-3-4-6-8(7)10/h3-6H,2H2,1H3 |
| CAS Registry Number |
446-22-0 |
| EINECS |
244-220-7 |
| Molecular Structure |
|
| Density |
1.074g/cm3 |
| Boiling point |
204.119°C at 760 mmHg |
| Refractive index |
1.489 |
| Flash point |
77.067°C |
| Vapour Pressur |
0.268mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
