| product Name |
2-Bromo-5-fluoronitrobenzene |
| Synonyms |
1-Bromo-4-fluoro-2-nitrobenzene |
| Molecular Formula |
C6H3BrFNO2 |
| Molecular Weight |
219.9959 |
| InChI |
InChI=1/C6H3BrFNO2/c7-5-2-1-4(8)3-6(5)9(10)11/h1-3H |
| CAS Registry Number |
446-09-3 |
| EINECS |
207-160-2 |
| Molecular Structure |
|
| Density |
1.808g/cm3 |
| Melting point |
37-39℃ |
| Boiling point |
220.9°C at 760 mmHg |
| Refractive index |
1.579 |
| Flash point |
87.4°C |
| Vapour Pressur |
0.164mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
