product Name |
2-Chloro-6-fluorobenzaldoxime |
Synonyms |
2-Chloro-6-fluorobenzaldehyde oxime |
Molecular Formula |
C7H5ClFNO |
Molecular Weight |
173.5721 |
InChI |
InChI=1/C7H5ClFNO/c8-6-2-1-3-7(9)5(6)4-10-11/h1-4,11H |
CAS Registry Number |
443-33-4 |
EINECS |
207-135-6 |
Molecular Structure |
|
Density |
1.32g/cm3 |
Melting point |
133℃ |
Boiling point |
238°C at 760 mmHg |
Refractive index |
1.533 |
Flash point |
97.8°C |
Vapour Pressur |
0.0237mmHg at 25°C |
Hazard Symbols |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|