| product Name |
(±)-2-Amino-1-butanol |
| Synonyms |
(-)-2-Aminobutanol; .+/-.-2-Amino-1-butanol; 1-butanol, 2-amino-; 202-488-2; 2-Aminobutan-1-ol; 96-20-8; (2S)-1-hydroxybutan-2-aminium; (2R)-1-hydroxybutan-2-aminium |
| Molecular Formula |
C4H12NO |
| Molecular Weight |
90.1436 |
| InChI |
InChI=1/C4H11NO/c1-2-4(5)3-6/h4,6H,2-3,5H2,1H3/p+1/t4-/m1/s1 |
| CAS Registry Number |
96-20-8 |
| EINECS |
202-488-2 |
| Molecular Structure |
|
| Melting point |
-2℃ |
| Boiling point |
177.2°C at 760 mmHg |
| Flash point |
82.2°C |
| Vapour Pressur |
0.319mmHg at 25°C |
| Hazard Symbols |
C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|