| product Name |
1H-Pyrazole-3-carboxylicacid, 5-methyl- |
| Synonyms |
3-methyl-1H-pyrazole-5-carboxylic acid; 5-Methyl-1H-pyrazole-3-carboxylic acid; 5-methylpyrazole-3-carboxylic acid |
| Molecular Formula |
C5H6N2O2 |
| Molecular Weight |
126.11 |
| InChI |
InChI=1/C5H6N2O2/c1-3-2-4(5(8)9)7-6-3/h2H,1H3,(H,6,7)(H,8,9) |
| CAS Registry Number |
696-22-0;402-61-9 |
| EINECS |
206-953-0 |
| Molecular Structure |
|
| Density |
1.404 g/cm3 |
| Boiling point |
388.8 °C at 760 mmHg |
| Refractive index |
1.595 |
| Flash point |
188.9 °C |
| Vapour Pressur |
9.69E-07mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|