product Name |
ethylchlorofluoroacetate |
Synonyms |
Ethyl chlorofluoroacetate; Chlorofluoroacetic acid ethyl ester; ethyl (2S)-chloro(fluoro)ethanoate; ethyl (2R)-chloro(fluoro)ethanoate |
Molecular Formula |
C4H6ClFO2 |
Molecular Weight |
140.5406 |
InChI |
InChI=1/C4H6ClFO2/c1-2-8-4(7)3(5)6/h3H,2H2,1H3/t3-/m0/s1 |
CAS Registry Number |
401-56-9 |
EINECS |
206-930-5 |
Molecular Structure |
|
Density |
1.219g/cm3 |
Boiling point |
129°C at 760 mmHg |
Refractive index |
1.39 |
Flash point |
44.3°C |
Vapour Pressur |
10.4mmHg at 25°C |
Hazard Symbols |
C:Corrosive;
|
Risk Codes |
R34:Causes burns.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|