| product Name |
1,1,2-trifluoropenta-1,4-diene |
| Synonyms |
|
| Molecular Formula |
C5H5F3 |
| Molecular Weight |
122.0884 |
| InChI |
InChI=1/C5H5F3/c1-2-3-4(6)5(7)8/h2H,1,3H2 |
| CAS Registry Number |
401-49-0 |
| Molecular Structure |
|
| Density |
1.055g/cm3 |
| Boiling point |
49.7°C at 760 mmHg |
| Refractive index |
1.354 |
| Vapour Pressur |
309mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|