| 
  
    | product Name | 5-Norbornene-2-carbonitrile, mixture of endo and exo |  
    | Synonyms | Bicyclo[2.2.1]-5-heptene-2-carbonitrile; bicyclo[2.2.1]hept-5-ene-2-carbonitrile; 5-Norbornene-2-carbonitrile; 5-Cyanobicyclo[2.2.1]hept-2-ene |  
    | Molecular Formula | C8H9N |  
    | Molecular Weight | 119.1638 |  
    | InChI | InChI=1/C8H9N/c9-5-8-4-6-1-2-7(8)3-6/h1-2,6-8H,3-4H2 |  
    | CAS Registry Number | 95-11-4 |  
    | EINECS | 202-391-5 |  
    | Molecular Structure |   |  
    | Density | 1.06g/cm3 |  
    | Melting point | 12-14℃ |  
    | Boiling point | 205.2°C at 760 mmHg |  
    | Refractive index | 1.531 |  
    | Flash point | 65.6°C |  
    | Vapour Pressur | 0.254mmHg at 25°C |  
    | Hazard Symbols |  Xn:Harmful; 
 |  
    | Risk Codes | R20/21/22:; 
 |  
    | Safety Description | S36/37:; 
 |  |