| 
  
    | product Name | 2,2'-ethylenedioxydiethyl bis(2-ethylbutyrate) |  
    | Synonyms | Triethylene glycol bis(2-ethylbutyrate); 2,2'-(Ethylenedioxy)di(ethyl 2-ethylbutyrate); 2-Ethylbutric acid, triethylene glycol diester; 2-Ethylbutyric acid, diester with triethylene glycol; 2-Ethylbutyric acid, triethylene glycol diester; 4-02-00-00951 (Beilstein Handbook Reference); AI3-01456; BRN 1804092; Butanoic acid, 2-ethyl-, 1,2-ethanediylbis(oxy-2,1-ethanediyl) ester; Butyric acid, 2-ethyl-, diester with triethylene glycol; Flexol plasticizer 3GH; HSDB 5285; NSC 406329; Plasticizer 3GH; Triethylene glycol bis(2-ethyl butyrate); Triethylene glycol di(2-ethyl butyrate); Triethylene glycol di-2-ethylbutyrate; Triethylene glycol, bis(2-ethylbutyrate); Triethyleneglycol diethyl butyrate; Triglycol di-(2-ethylbutyrate); Triglycol dicaproate; Triglycol dihexoate; 2,2'-Ethylenedioxydiethyl bis(2-ethylbutyrate); Butanoic acid, 2-ethyl-, 1,1'-(1,2-ethanediylbis(oxy-2,1-ethanediyl)) ester; Triethylene glycol di-(2-ethylbutyrate); ethane-1,2-diylbis(oxyethane-2,1-diyl) bis(2-ethylbutanoate) |  
    | Molecular Formula | C18H34O6 |  
    | Molecular Weight | 346.459 |  
    | InChI | InChI=1/C18H34O6/c1-5-15(6-2)17(19)23-13-11-21-9-10-22-12-14-24-18(20)16(7-3)8-4/h15-16H,5-14H2,1-4H3 |  
    | CAS Registry Number | 95-08-9 |  
    | EINECS | 202-389-4 |  
    | Molecular Structure |   |  
    | Density | 1.001g/cm3 |  
    | Boiling point | 409°C at 760 mmHg |  
    | Refractive index | 1.446 |  
    | Flash point | 173.5°C |  
    | Vapour Pressur | 6.69E-07mmHg at 25°C |  
    | Hazard Symbols |  |  
    | Risk Codes |  |  
    | Safety Description |  |  |