| product Name |
2,2'-ethylenedioxydiethyl bis(2-ethylbutyrate) |
| Synonyms |
Triethylene glycol bis(2-ethylbutyrate); 2,2'-(Ethylenedioxy)di(ethyl 2-ethylbutyrate); 2-Ethylbutric acid, triethylene glycol diester; 2-Ethylbutyric acid, diester with triethylene glycol; 2-Ethylbutyric acid, triethylene glycol diester; 4-02-00-00951 (Beilstein Handbook Reference); AI3-01456; BRN 1804092; Butanoic acid, 2-ethyl-, 1,2-ethanediylbis(oxy-2,1-ethanediyl) ester; Butyric acid, 2-ethyl-, diester with triethylene glycol; Flexol plasticizer 3GH; HSDB 5285; NSC 406329; Plasticizer 3GH; Triethylene glycol bis(2-ethyl butyrate); Triethylene glycol di(2-ethyl butyrate); Triethylene glycol di-2-ethylbutyrate; Triethylene glycol, bis(2-ethylbutyrate); Triethyleneglycol diethyl butyrate; Triglycol di-(2-ethylbutyrate); Triglycol dicaproate; Triglycol dihexoate; 2,2'-Ethylenedioxydiethyl bis(2-ethylbutyrate); Butanoic acid, 2-ethyl-, 1,1'-(1,2-ethanediylbis(oxy-2,1-ethanediyl)) ester; Triethylene glycol di-(2-ethylbutyrate); ethane-1,2-diylbis(oxyethane-2,1-diyl) bis(2-ethylbutanoate) |
| Molecular Formula |
C18H34O6 |
| Molecular Weight |
346.459 |
| InChI |
InChI=1/C18H34O6/c1-5-15(6-2)17(19)23-13-11-21-9-10-22-12-14-24-18(20)16(7-3)8-4/h15-16H,5-14H2,1-4H3 |
| CAS Registry Number |
95-08-9 |
| EINECS |
202-389-4 |
| Molecular Structure |
|
| Density |
1.001g/cm3 |
| Boiling point |
409°C at 760 mmHg |
| Refractive index |
1.446 |
| Flash point |
173.5°C |
| Vapour Pressur |
6.69E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|