| product Name |
trans-2-ethoxy-5-(1-propenyl)phenol |
| Synonyms |
2-Ethoxy-5-prop-1-enylphenol; 5-propenylguaethol; Vanitrope; 2-ethoxy-5-(prop-1-en-1-yl)phenol; 2-ethoxy-5-[(1E)-prop-1-en-1-yl]phenol |
| Molecular Formula |
C11H14O2 |
| Molecular Weight |
178.2277 |
| InChI |
InChI=1/C11H14O2/c1-3-5-9-6-7-11(13-4-2)10(12)8-9/h3,5-8,12H,4H2,1-2H3/b5-3+ |
| CAS Registry Number |
94-86-0 |
| EINECS |
202-370-0 |
| Molecular Structure |
|
| Density |
1.052g/cm3 |
| Melting point |
86-88℃ |
| Boiling point |
312.8°C at 760 mmHg |
| Refractive index |
1.567 |
| Flash point |
165.2°C |
| Vapour Pressur |
0.000281mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
