| 
  
    | product Name | Methyl benzoate |  
    | Synonyms | Benzoic acid methyl ester; clorius; essence of niobe; methyl benzenecarboxylate; Niobe oil; Oil of niobe; oniobe oil; oxidate le |  
    | Molecular Formula | C8H8O2 |  
    | Molecular Weight | 136.1479 |  
    | InChI | InChI=1/C8H8O2/c1-10-8(9)7-5-3-2-4-6-7/h2-6H,1H3 |  
    | CAS Registry Number | 93-58-3 |  
    | EINECS | 202-259-7 |  
    | Molecular Structure |   |  
    | Density | 1.069g/cm3 |  
    | Melting point | -12℃ |  
    | Boiling point | 199.5°C at 760 mmHg |  
    | Refractive index | 1.509 |  
    | Flash point | 80.2°C |  
    | Water solubility | <0.1 g/100 mL at 22.5℃ |  
    | Vapour Pressur | 0.34mmHg at 25°C |  
    | Hazard Symbols |  Xn:Harmful; 
 |  
    | Risk Codes | R22:; 
 |  
    | Safety Description | S36:; 
 |  |