product Name |
2-Phenylpropionaldehyde |
Synonyms |
2-Phenylpropanal; alpha-methylphenylacetaldehyde; hydratopic aldehyde |
Molecular Formula |
C9H10O |
Molecular Weight |
134.1751 |
InChI |
InChI=1/C9H10O/c1-8(7-10)9-5-3-2-4-6-9/h2-8H,1H3 |
CAS Registry Number |
93-53-8 |
EINECS |
202-255-5 |
Molecular Structure |
|
Density |
0.98g/cm3 |
Boiling point |
202.3°C at 760 mmHg |
Refractive index |
1.505 |
Flash point |
76.1°C |
Vapour Pressur |
0.294mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R36/38:Irritating to eyes and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|