| product Name |
Benzene, 1,2-dimethoxy-4-(1-propenyl)- |
| Synonyms |
1,2-Dimethoxy-4-propen-1-yl benzene; 3,4-Dimethoxy-1,1-propen-1-yl benzene; Isoeugenenyl methyl ether; Isoeugenol methyl ether; Isoeugenyl methyl ether; Methyl isoeugenol; ; 1,2-dimethoxy-4-(prop-1-en-1-yl)benzene; 2-methoxy-3-methyl-4-[(1E)-prop-1-en-1-yl]phenol; 2-methoxy-4-[(1E)-prop-1-en-1-yl]phenol - methoxymethane (1:1); 1,2-dimethoxy-4-[(Z)-prop-1-enyl]benzene |
| Molecular Formula |
C11H14O2 |
| Molecular Weight |
178.2277 |
| InChI |
InChI=1/C11H14O2/c1-4-5-9-6-7-10(12-2)11(8-9)13-3/h4-8H,1-3H3/b5-4- |
| CAS Registry Number |
93-16-3 |
| EINECS |
202-224-6 |
| Molecular Structure |
|
| Density |
0.998g/cm3 |
| Melting point |
62.6℃ |
| Boiling point |
271.1°C at 760 mmHg |
| Refractive index |
1.534 |
| Flash point |
104.5°C |
| Vapour Pressur |
0.011mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
