93-16-3 Benzene, 1,2-dimethoxy-4-(1-propenyl)-
cas

93-16-3 Benzene, 1,2-dimethoxy-4-(1-propenyl)-

product Name Benzene, 1,2-dimethoxy-4-(1-propenyl)-
Synonyms 1,2-Dimethoxy-4-propen-1-yl benzene; 3,4-Dimethoxy-1,1-propen-1-yl benzene; Isoeugenenyl methyl ether; Isoeugenol methyl ether; Isoeugenyl methyl ether; Methyl isoeugenol; ; 1,2-dimethoxy-4-(prop-1-en-1-yl)benzene; 2-methoxy-3-methyl-4-[(1E)-prop-1-en-1-yl]phenol; 2-methoxy-4-[(1E)-prop-1-en-1-yl]phenol - methoxymethane (1:1); 1,2-dimethoxy-4-[(Z)-prop-1-enyl]benzene
Molecular Formula C11H14O2
Molecular Weight 178.2277
InChI InChI=1/C11H14O2/c1-4-5-9-6-7-10(12-2)11(8-9)13-3/h4-8H,1-3H3/b5-4-
CAS Registry Number 93-16-3
EINECS 202-224-6
Molecular Structure 93-16-3 Benzene, 1,2-dimethoxy-4-(1-propenyl)-
Density 0.998g/cm3
Melting point 62.6℃
Boiling point 271.1°C at 760 mmHg
Refractive index 1.534
Flash point 104.5°C
Vapour Pressur 0.011mmHg at 25°C
Hazard Symbols
Risk Codes R36/38:Irritating to eyes and skin.;
Safety Description S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
1 2 3 4 5 6 7 8 9