| product Name |
1-Chloro-2,5-diethoxy-4-nitrobenzene |
| Synonyms |
Benzene, 1-chloro-2,5-diethoxy-4-nitro-; 2,5-Diethoxy-4-nitrochlorobenzene; 5-Chloro-2-nitro-p-diethoxybenzene; NSC 60284 |
| Molecular Formula |
C10H12ClNO4 |
| Molecular Weight |
245.6596 |
| InChI |
InChI=1/C10H12ClNO4/c1-3-15-9-6-8(12(13)14)10(16-4-2)5-7(9)11/h5-6H,3-4H2,1-2H3 |
| CAS Registry Number |
91-43-0 |
| EINECS |
202-067-3 |
| Molecular Structure |
|
| Density |
1.264g/cm3 |
| Boiling point |
368.4°C at 760 mmHg |
| Refractive index |
1.533 |
| Flash point |
176.6°C |
| Vapour Pressur |
2.7E-05mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|