product Name |
4-Bromobenzophenone |
Synonyms |
Benzophenone, 4-bromo-; 4-07-00-01378 (Beilstein Handbook Reference); 4-Bromophenyl phenyl ketone; BRN 1910182; NSC 59863; USAF DO-3; p-Benzoylbromobenzene; p-Bromobenzophenone; Methanone, (4-bromophenyl)phenyl-; Methanone, (4-bromophenyl)phenyl- (9CI); (4-bromophenyl)(phenyl)methanone |
Molecular Formula |
C13H9BrO |
Molecular Weight |
261.114 |
InChI |
InChI=1/C13H9BrO/c14-12-8-6-11(7-9-12)13(15)10-4-2-1-3-5-10/h1-9H |
CAS Registry Number |
90-90-4 |
EINECS |
202-024-9 |
Molecular Structure |
|
Density |
1.421g/cm3 |
Melting point |
78-82℃ |
Boiling point |
346.8°C at 760 mmHg |
Refractive index |
1.61 |
Flash point |
81.3°C |
Vapour Pressur |
5.62E-05mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|