| 
  
    | product Name | 1-(3-Chlorophenyl)-3-methyl-2-pyrazolin-5-one |  
    | Synonyms | 2-(3-Chlorophenyl)-2,4-dihydro-5-methyl-3H-pyrazol-3-one; 1-(3'-Chlorophenyl)-3-methyl-5-pyrazolone; 2-(3-chlorophenyl)-5-methyl-2,4-dihydro-3H-pyrazol-3-one |  
    | Molecular Formula | C10H9ClN2O |  
    | Molecular Weight | 208.6443 |  
    | InChI | InChI=1/C10H9ClN2O/c1-7-5-10(14)13(12-7)9-4-2-3-8(11)6-9/h2-4,6H,5H2,1H3 |  
    | CAS Registry Number | 90-31-3 |  
    | EINECS | 201-984-6 |  
    | Molecular Structure |   |  
    | Density | 1.32g/cm3 |  
    | Melting point | 128-131℃ |  
    | Boiling point | 382.9°C at 760 mmHg |  
    | Refractive index | 1.625 |  
    | Flash point | 185.4°C |  
    | Vapour Pressur | 4.57E-06mmHg at 25°C |  
    | Hazard Symbols |  |  
    | Risk Codes |  |  
    | Safety Description | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.;
 
 |  |