| product Name |
2-Hydroxy-4,6-dimethoxyacetophenone |
| Molecular Formula |
C10H12O4 |
| Molecular Weight |
196.1999 |
| InChI |
InChI=1/C10H12O4/c1-6(11)10-8(12)4-7(13-2)5-9(10)14-3/h4-5,12H,1-3H3 |
| CAS Registry Number |
90-24-4 |
| EINECS |
201-978-3 |
| Molecular Structure |
|
| Density |
1.172g/cm3 |
| Melting point |
80-82℃ |
| Boiling point |
355.1°C at 760 mmHg |
| Refractive index |
1.527 |
| Flash point |
141.2°C |
| Vapour Pressur |
1.57E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
