| product Name |
1,1-dimethylhydrazine - hydrazine (1:1) |
| Synonyms |
1,1-Dimethylhydrazine - hydrazine (1:1); Hydrazine, 1,1-dimethyl-, mixt. with hydrazine (9CI); hydrazine, compd. with 1,1-dimethylhydrazine (1:1) |
| Molecular Formula |
C2H12N4 |
| Molecular Weight |
92.1435 |
| InChI |
InChI=1/C2H8N2.H4N2/c1-4(2)3;1-2/h3H2,1-2H3;1-2H2 |
| CAS Registry Number |
8065-75-6 |
| Molecular Structure |
|
| Boiling point |
63.9°C at 760 mmHg |
| Flash point |
1.1°C |
| Vapour Pressur |
168mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
